C27H40N2O4 — CID 53339944
methyl (E)-4-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethylamino]-4-oxobut-2-enoate (PubChem CID 53339944) has the molecular formula C27H40N2O4 and a molecular weight of 456.63 g/mol. Its IUPAC name is methyl (E)-4-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethylamino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 53339944 |
| Molecular Formula | C27H40N2O4 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | methyl (E)-4-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethylamino]-4-oxobut-2-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCNC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C27H40N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(30)28-23-24-29-26(31)21-22-27(32)33-2/h4-5,7-8,10-11,13-14,16-17,21-22H,3,6,9,12,15,18-20,23-24H2,1-2H3,(H,28,30)(H,29,31)/b5-4-,8-7-,11-10-,14-13-,17-16-,22-21+ |
| InChIKey | CDVAUFYPGYEYFU-CXSAKVLUSA-N |
| XLogP | 4.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|