C32H49N3O4 — CID 53340176
methyl (E)-4-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl-methylamino]ethylamino]-4-oxobut-2-enoate (PubChem CID 53340176) has the molecular formula C32H49N3O4 and a molecular weight of 539.76 g/mol. Its IUPAC name is methyl (E)-4-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl-methylamino]ethylamino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl-methylamino]ethylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 53340176 |
| Molecular Formula | C32H49N3O4 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.37 |
| IUPAC Name | methyl (E)-4-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl-methylamino]ethylamino]-4-oxobut-2-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCN(C)CCNC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C32H49N3O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-30(36)33-26-28-35(2)29-27-34-31(37)24-25-32(38)39-3/h5-6,8-9,11-12,14-15,17-18,20-21,24-25H,4,7,10,13,16,19,22-23,26-29H2,1-3H3,(H,33,36)(H,34,37)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20-,25-24+ |
| InChIKey | NBGHIEIPZJVZSC-VBRNPVKNSA-N |
| XLogP | 5.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|