C33H56FN3O5 — CID 53340274
(2S,4S,5S,7R)-5-amino-N-[(1S)-1-cyclohexylethyl]-N'-[4-fluoro-2-(3-methoxypropoxy)phenyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide (PubChem CID 53340274) has the molecular formula C33H56FN3O5 and a molecular weight of 593.83 g/mol. Its IUPAC name is (2S,4S,5S,7R)-5-amino-N-[(1S)-1-cyclohexylethyl]-N'-[4-fluoro-2-(3-methoxypropoxy)phenyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide.
| Compound Name | (2S,4S,5S,7R)-5-amino-N-[(1S)-1-cyclohexylethyl]-N'-[4-fluoro-2-(3-methoxypropoxy)phenyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide |
|---|---|
| PubChem CID | 53340274 |
| Molecular Formula | C33H56FN3O5 |
| Molecular Weight | 593.83 g/mol |
| Exact Mass | 593.42 |
| IUPAC Name | (2S,4S,5S,7R)-5-amino-N-[(1S)-1-cyclohexylethyl]-N'-[4-fluoro-2-(3-methoxypropoxy)phenyl]-4-hydroxy-2,7-di(propan-2-yl)nonanediamide |
| SMILES | COCCCOc1cc(F)ccc1NC(=O)C[C@@H](C[C@H](N)[C@@H](O)CC(C(=O)N[C@@H](C)C1CCCCC1)C(C)C)C(C)C |
| InChI | InChI=1S/C33H56FN3O5/c1-21(2)25(18-32(39)37-29-14-13-26(34)19-31(29)42-16-10-15-41-6)17-28(35)30(38)20-27(22(3)4)33(40)36-23(5)24-11-8-7-9-12-24/h13-14,19,21-25,27-28,30,38H,7-12,15-18,20,35H2,1-6H3,(H,36,40)(H,37,39)/t23-,25+,27?,28-,30-/m0/s1 |
| InChIKey | JUGQIGCLTGLWTR-HJBCDSSQSA-N |
| XLogP | 5.67 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.83 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|