C30H47N3O4 — CID 53340285
methyl (E)-4-[2-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl-methylamino]ethylamino]-4-oxobut-2-enoate (PubChem CID 53340285) has the molecular formula C30H47N3O4 and a molecular weight of 513.72 g/mol. Its IUPAC name is methyl (E)-4-[2-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl-methylamino]ethylamino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[2-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl-methylamino]ethylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 53340285 |
| Molecular Formula | C30H47N3O4 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.36 |
| IUPAC Name | methyl (E)-4-[2-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl-methylamino]ethylamino]-4-oxobut-2-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCN(C)CCNC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C30H47N3O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28(34)31-24-26-33(2)27-25-32-29(35)22-23-30(36)37-3/h5-6,8-9,11-12,14-15,17-18,22-23H,4,7,10,13,16,19-21,24-27H2,1-3H3,(H,31,34)(H,32,35)/b6-5-,9-8-,12-11-,15-14-,18-17-,23-22+ |
| InChIKey | JZQCJDDMLSFOPL-MHYYZSRASA-N |
| XLogP | 4.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|