C35H44O9S2 — CID 53340297
4-[2-[3-[3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]propyldisulfanyl]propoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 53340297) has the molecular formula C35H44O9S2 and a molecular weight of 672.86 g/mol. Its IUPAC name is 4-[2-[3-[3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]propyldisulfanyl]propoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[3-[3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]propyldisulfanyl]propoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 53340297 |
| Molecular Formula | C35H44O9S2 |
| Molecular Weight | 672.86 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | 4-[2-[3-[3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]propyldisulfanyl]propoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | COc1ccc(C(OCCOCCCSSCCCOCCOC(=O)CCC(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H44O9S2/c1-39-31-14-10-29(11-15-31)35(28-8-4-3-5-9-28,30-12-16-32(40-2)17-13-30)44-25-23-42-21-7-27-46-45-26-6-20-41-22-24-43-34(38)19-18-33(36)37/h3-5,8-17H,6-7,18-27H2,1-2H3,(H,36,37) |
| InChIKey | CSVPKLKQIMWZHY-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.86 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|