C27H28F2N2O4 — CID 53340312
4-[bis(4-fluorophenyl)-hydroxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (PubChem CID 53340312) has the molecular formula C27H28F2N2O4 and a molecular weight of 482.53 g/mol. Its IUPAC name is 4-[bis(4-fluorophenyl)-hydroxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide.
| Compound Name | 4-[bis(4-fluorophenyl)-hydroxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
|---|---|
| PubChem CID | 53340312 |
| Molecular Formula | C27H28F2N2O4 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 4-[bis(4-fluorophenyl)-hydroxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
| SMILES | O=C(CCCCCCNC(=O)c1ccc(C(O)(c2ccc(F)cc2)c2ccc(F)cc2)cc1)NO |
| InChI | InChI=1S/C27H28F2N2O4/c28-23-14-10-21(11-15-23)27(34,22-12-16-24(29)17-13-22)20-8-6-19(7-9-20)26(33)30-18-4-2-1-3-5-25(32)31-35/h6-17,34-35H,1-5,18H2,(H,30,33)(H,31,32) |
| InChIKey | XPBDCNJALIOABV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|