C13H28O3Si2 — CID 533404
trimethylsilyl 4-trimethylsilyloxycyclohexane-1-carboxylate (PubChem CID 533404) has the molecular formula C13H28O3Si2 and a molecular weight of 288.54 g/mol. Its IUPAC name is trimethylsilyl 4-trimethylsilyloxycyclohexane-1-carboxylate.
| Compound Name | trimethylsilyl 4-trimethylsilyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 533404 |
| Molecular Formula | C13H28O3Si2 |
| Molecular Weight | 288.54 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | trimethylsilyl 4-trimethylsilyloxycyclohexane-1-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1CCC(O[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C13H28O3Si2/c1-17(2,3)15-12-9-7-11(8-10-12)13(14)16-18(4,5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | GKOJEADQXLHCDU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|