C27H31N3O11S — CID 53340470
1-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]carbamoyl]oxyethyl (5S)-5,6-dinitrooxyhexanoate (PubChem CID 53340470) has the molecular formula C27H31N3O11S and a molecular weight of 605.62 g/mol. Its IUPAC name is 1-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]carbamoyl]oxyethyl (5S)-5,6-dinitrooxyhexanoate.
| Compound Name | 1-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]carbamoyl]oxyethyl (5S)-5,6-dinitrooxyhexanoate |
|---|---|
| PubChem CID | 53340470 |
| Molecular Formula | C27H31N3O11S |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | 1-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]carbamoyl]oxyethyl (5S)-5,6-dinitrooxyhexanoate |
| SMILES | CC(OC(=O)CCC[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-])OC(=O)N(C)CC[C@H](Oc1cccc2ccccc12)c1cccs1 |
| InChI | InChI=1S/C27H31N3O11S/c1-19(38-26(31)14-6-10-21(41-30(35)36)18-37-29(33)34)39-27(32)28(2)16-15-24(25-13-7-17-42-25)40-23-12-5-9-20-8-3-4-11-22(20)23/h3-5,7-9,11-13,17,19,21,24H,6,10,14-16,18H2,1-2H3/t19?,21-,24-/m0/s1 |
| InChIKey | UNFNSFXMDWPQHB-VFXOEBCRSA-N |
| XLogP | 5.32 |
| TPSA | 169.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|