C28H42N2O4 — CID 53340519
ethyl (E)-4-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethylamino]-4-oxobut-2-enoate (PubChem CID 53340519) has the molecular formula C28H42N2O4 and a molecular weight of 470.65 g/mol. Its IUPAC name is ethyl (E)-4-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethylamino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 53340519 |
| Molecular Formula | C28H42N2O4 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | ethyl (E)-4-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethylamino]-4-oxobut-2-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCNC(=O)/C=C/C(=O)OCC |
| InChI | InChI=1S/C28H42N2O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26(31)29-24-25-30-27(32)22-23-28(33)34-4-2/h5-6,8-9,11-12,14-15,17-18,22-23H,3-4,7,10,13,16,19-21,24-25H2,1-2H3,(H,29,31)(H,30,32)/b6-5-,9-8-,12-11-,15-14-,18-17-,23-22+ |
| InChIKey | JSXSFRZTXHZNSC-MHYYZSRASA-N |
| XLogP | 5.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|