C41H75NO2 — CID 53340617
4,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]piperidine (PubChem CID 53340617) has the molecular formula C41H75NO2 and a molecular weight of 614.06 g/mol. Its IUPAC name is 4,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]piperidine.
| Compound Name | 4,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]piperidine |
|---|---|
| PubChem CID | 53340617 |
| Molecular Formula | C41H75NO2 |
| Molecular Weight | 614.06 g/mol |
| Exact Mass | 613.58 |
| IUPAC Name | 4,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]piperidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC1(OCCCCCCCC/C=C\C/C=C\CCCCC)CCNCC1 |
| InChI | InChI=1S/C41H75NO2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39-43-41(35-37-42-38-36-41)44-40-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,42H,3-10,15-16,21-40H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | WBQFFZTXYSVUBO-MAZCIEHSSA-N |
| XLogP | 12.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.06 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|