C31H39N3O9S2 — CID 53340834
1-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]carbamoyl]oxyethyl 2-[(2,2-dimethyl-3-nitrooxypropanoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 53340834) has the molecular formula C31H39N3O9S2 and a molecular weight of 661.80 g/mol. Its IUPAC name is 1-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]carbamoyl]oxyethyl 2-[(2,2-dimethyl-3-nitrooxypropanoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | 1-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]carbamoyl]oxyethyl 2-[(2,2-dimethyl-3-nitrooxypropanoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 53340834 |
| Molecular Formula | C31H39N3O9S2 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.21 |
| IUPAC Name | 1-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]carbamoyl]oxyethyl 2-[(2,2-dimethyl-3-nitrooxypropanoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)C(C)(C)CO[N+](=O)[O-])C(=O)OC(C)OC(=O)N(C)CC[C@H](Oc1cccc2ccccc12)c1cccs1 |
| InChI | InChI=1S/C31H39N3O9S2/c1-21(41-28(35)24(16-19-44-5)32-29(36)31(2,3)20-40-34(38)39)42-30(37)33(4)17-15-26(27-14-9-18-45-27)43-25-13-8-11-22-10-6-7-12-23(22)25/h6-14,18,21,24,26H,15-17,19-20H2,1-5H3,(H,32,36)/t21?,24?,26-/m0/s1 |
| InChIKey | DTUZSNAKZDYQTP-QVKCHMKDSA-N |
| XLogP | 5.84 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|