C15H16F3N5 — CID 53340959
3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 53340959) has the molecular formula C15H16F3N5 and a molecular weight of 323.32 g/mol. Its IUPAC name is 3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 53340959 |
| Molecular Formula | C15H16F3N5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | FC(F)(F)CN1CCC(n2cnc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C15H16F3N5/c16-15(17,18)8-22-5-2-10(3-6-22)23-9-21-12-7-20-14-11(13(12)23)1-4-19-14/h1,4,7,9-10H,2-3,5-6,8H2,(H,19,20) |
| InChIKey | FOKOEDIQNRPGOY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |