C30H23F3N4O4S — CID 53340973
[N-(2,5-difluorophenyl)sulfonyl-3-(1-ethyl-4-pyridin-4-ylpyrazol-3-yl)-4-fluoroanilino]methyl benzoate (PubChem CID 53340973) has the molecular formula C30H23F3N4O4S and a molecular weight of 592.60 g/mol. Its IUPAC name is [N-(2,5-difluorophenyl)sulfonyl-3-(1-ethyl-4-pyridin-4-ylpyrazol-3-yl)-4-fluoroanilino]methyl benzoate.
| Compound Name | [N-(2,5-difluorophenyl)sulfonyl-3-(1-ethyl-4-pyridin-4-ylpyrazol-3-yl)-4-fluoroanilino]methyl benzoate |
|---|---|
| PubChem CID | 53340973 |
| Molecular Formula | C30H23F3N4O4S |
| Molecular Weight | 592.60 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | [N-(2,5-difluorophenyl)sulfonyl-3-(1-ethyl-4-pyridin-4-ylpyrazol-3-yl)-4-fluoroanilino]methyl benzoate |
| SMILES | CCn1cc(-c2ccncc2)c(-c2cc(N(COC(=O)c3ccccc3)S(=O)(=O)c3cc(F)ccc3F)ccc2F)n1 |
| InChI | InChI=1S/C30H23F3N4O4S/c1-2-36-18-25(20-12-14-34-15-13-20)29(35-36)24-17-23(9-11-26(24)32)37(19-41-30(38)21-6-4-3-5-7-21)42(39,40)28-16-22(31)8-10-27(28)33/h3-18H,2,19H2,1H3 |
| InChIKey | OCGBUVOZPMPSKN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|