C29H22F4N6O4S — CID 53341228
[3-[4-(2-aminopyrimidin-4-yl)-1-ethylpyrazol-3-yl]-N-(2,5-difluorophenyl)sulfonyl-2,4-difluoroanilino]methyl benzoate (PubChem CID 53341228) has the molecular formula C29H22F4N6O4S and a molecular weight of 626.59 g/mol. Its IUPAC name is [3-[4-(2-aminopyrimidin-4-yl)-1-ethylpyrazol-3-yl]-N-(2,5-difluorophenyl)sulfonyl-2,4-difluoroanilino]methyl benzoate.
| Compound Name | [3-[4-(2-aminopyrimidin-4-yl)-1-ethylpyrazol-3-yl]-N-(2,5-difluorophenyl)sulfonyl-2,4-difluoroanilino]methyl benzoate |
|---|---|
| PubChem CID | 53341228 |
| Molecular Formula | C29H22F4N6O4S |
| Molecular Weight | 626.59 g/mol |
| Exact Mass | 626.14 |
| IUPAC Name | [3-[4-(2-aminopyrimidin-4-yl)-1-ethylpyrazol-3-yl]-N-(2,5-difluorophenyl)sulfonyl-2,4-difluoroanilino]methyl benzoate |
| SMILES | CCn1cc(-c2ccnc(N)n2)c(-c2c(F)ccc(N(COC(=O)c3ccccc3)S(=O)(=O)c3cc(F)ccc3F)c2F)n1 |
| InChI | InChI=1S/C29H22F4N6O4S/c1-2-38-15-19(22-12-13-35-29(34)36-22)27(37-38)25-21(32)10-11-23(26(25)33)39(16-43-28(40)17-6-4-3-5-7-17)44(41,42)24-14-18(30)8-9-20(24)31/h3-15H,2,16H2,1H3,(H2,34,35,36) |
| InChIKey | RQMWSCRRJFUVGX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 133.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|