C19H25N7O2S — CID 53341463
N-[2-[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]methanesulfonamide (PubChem CID 53341463) has the molecular formula C19H25N7O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[2-[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 53341463 |
| Molecular Formula | C19H25N7O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-[2-[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCc1nc2cnc3[nH]ccc3c2n1C1CCN(CCC#N)CC1 |
| InChI | InChI=1S/C19H25N7O2S/c1-29(27,28)23-9-4-17-24-16-13-22-19-15(3-8-21-19)18(16)26(17)14-5-11-25(12-6-14)10-2-7-20/h3,8,13-14,23H,2,4-6,9-12H2,1H3,(H,21,22) |
| InChIKey | KVZYKVBUDWHPDM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 119.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |