About 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one
2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one (PubChem CID 53341624) has the molecular formula C16H13NO4
and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one |
| PubChem CID | 53341624 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3cccnc3o2)cc1OC |
| InChI | InChI=1S/C16H13NO4/c1-19-13-6-5-10(8-15(13)20-2)14-9-12(18)11-4-3-7-17-16(11)21-14/h3-9H,1-2H3 |
| InChIKey | KMFYCGLGTPEPSM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one?
The IUPAC name of 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one (CID 53341624) is 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one is COc1ccc(-c2cc(=O)c3cccnc3o2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one?
The InChIKey is KMFYCGLGTPEPSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO4/c1-19-13-6-5-10(8-15(13)20-2)14-9-12(18)11-4-3-7-17-16(11)21-14/h3-9H,1-2H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one?
2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one has a molecular weight of 283.28 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)pyrano[2,3-b]pyridin-4-one is sourced from PubChem (CID 53341624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).