C27H51N2O12P — CID 53341690
[(2R)-2-hexanoyloxy-3-[hydroxy-[(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropoxy]phosphoryl]oxypropyl] 6-aminohexanoate (PubChem CID 53341690) has the molecular formula C27H51N2O12P and a molecular weight of 626.68 g/mol. Its IUPAC name is [(2R)-2-hexanoyloxy-3-[hydroxy-[(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropoxy]phosphoryl]oxypropyl] 6-aminohexanoate.
| Compound Name | [(2R)-2-hexanoyloxy-3-[hydroxy-[(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropoxy]phosphoryl]oxypropyl] 6-aminohexanoate |
|---|---|
| PubChem CID | 53341690 |
| Molecular Formula | C27H51N2O12P |
| Molecular Weight | 626.68 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | [(2R)-2-hexanoyloxy-3-[hydroxy-[(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropoxy]phosphoryl]oxypropyl] 6-aminohexanoate |
| SMILES | CCCCCC(=O)O[C@H](COC(=O)CCCCCN)COP(=O)(O)OC[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H51N2O12P/c1-8-9-11-15-23(31)39-20(17-36-22(30)14-12-10-13-16-28)18-37-42(34,35)38-19-21(24(32)40-26(2,3)4)29-25(33)41-27(5,6)7/h20-21H,8-19,28H2,1-7H3,(H,29,33)(H,34,35)/t20-,21+/m1/s1 |
| InChIKey | UPENUWYUIMRUDB-RTWAWAEBSA-N |
| XLogP | 3.91 |
| TPSA | 199.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|