C36H37F3NO+ — CID 53341729
(1R,3R,4S,7S,8S,10R)-8,10-dimethyl-3-naphthalen-1-yl-3-phenylmethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniatricyclo[5.2.1.04,10]decane (PubChem CID 53341729) has the molecular formula C36H37F3NO+ and a molecular weight of 556.69 g/mol. Its IUPAC name is (1R,3R,4S,7S,8S,10R)-8,10-dimethyl-3-naphthalen-1-yl-3-phenylmethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniatricyclo[5.2.1.04,10]decane.
| Compound Name | (1R,3R,4S,7S,8S,10R)-8,10-dimethyl-3-naphthalen-1-yl-3-phenylmethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 53341729 |
| Molecular Formula | C36H37F3NO+ |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | (1R,3R,4S,7S,8S,10R)-8,10-dimethyl-3-naphthalen-1-yl-3-phenylmethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniatricyclo[5.2.1.04,10]decane |
| SMILES | C[C@@H]1C[N@@+]2(Cc3ccc(C(F)(F)F)cc3)C[C@](OCc3ccccc3)(c3cccc4ccccc34)[C@H]3CC[C@@H]1[C@]32C |
| InChI | InChI=1S/C36H37F3NO/c1-25-21-40(22-26-15-17-29(18-16-26)36(37,38)39)24-35(33-20-19-31(25)34(33,40)2,41-23-27-9-4-3-5-10-27)32-14-8-12-28-11-6-7-13-30(28)32/h3-18,25,31,33H,19-24H2,1-2H3/q+1/t25-,31+,33+,34-,35+,40-/m1/s1 |
| InChIKey | LCMIZZUSSPHXOZ-RLIYKSQXSA-N |
| XLogP | 8.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|