C36H37BrN2O — CID 53341730
4-[[(1R,3R,4S,7S,8S,10R)-8,10-dimethyl-3-naphthalen-1-yl-3-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decan-1-yl]methyl]benzonitrile bromide (PubChem CID 53341730) has the molecular formula C36H37BrN2O and a molecular weight of 593.61 g/mol. Its IUPAC name is 4-[[(1R,3R,4S,7S,8S,10R)-8,10-dimethyl-3-naphthalen-1-yl-3-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decan-1-yl]methyl]benzonitrile bromide.
| Compound Name | 4-[[(1R,3R,4S,7S,8S,10R)-8,10-dimethyl-3-naphthalen-1-yl-3-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decan-1-yl]methyl]benzonitrile bromide |
|---|---|
| PubChem CID | 53341730 |
| Molecular Formula | C36H37BrN2O |
| Molecular Weight | 593.61 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 4-[[(1R,3R,4S,7S,8S,10R)-8,10-dimethyl-3-naphthalen-1-yl-3-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decan-1-yl]methyl]benzonitrile bromide |
| SMILES | C[C@@H]1C[N@@+]2(Cc3ccc(C#N)cc3)C[C@](OCc3ccccc3)(c3cccc4ccccc34)[C@H]3CC[C@@H]1[C@]32C.[Br-] |
| InChI | InChI=1S/C36H37N2O.BrH/c1-26-22-38(23-28-17-15-27(21-37)16-18-28)25-36(34-20-19-32(26)35(34,38)2,39-24-29-9-4-3-5-10-29)33-14-8-12-30-11-6-7-13-31(30)33;/h3-18,26,32,34H,19-20,22-25H2,1-2H3;1H/q+1;/p-1/t26-,32+,34+,35-,36+,38-;/m1./s1 |
| InChIKey | XBLBGFYRCXHBJF-GTFVDNBYSA-M |
| XLogP | 4.59 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|