C17H24O4 — CID 53341829
3-[(1R,7R,7aR)-7-(methoxymethoxy)-2-oxo-7a-prop-2-enyl-4,5,6,7-tetrahydro-1H-inden-1-yl]propanal (PubChem CID 53341829) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is 3-[(1R,7R,7aR)-7-(methoxymethoxy)-2-oxo-7a-prop-2-enyl-4,5,6,7-tetrahydro-1H-inden-1-yl]propanal.
| Compound Name | 3-[(1R,7R,7aR)-7-(methoxymethoxy)-2-oxo-7a-prop-2-enyl-4,5,6,7-tetrahydro-1H-inden-1-yl]propanal |
|---|---|
| PubChem CID | 53341829 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-[(1R,7R,7aR)-7-(methoxymethoxy)-2-oxo-7a-prop-2-enyl-4,5,6,7-tetrahydro-1H-inden-1-yl]propanal |
| SMILES | C=CC[C@]12C(=CC(=O)[C@@H]1CCC=O)CCC[C@H]2OCOC |
| InChI | InChI=1S/C17H24O4/c1-3-9-17-13(6-4-8-16(17)21-12-20-2)11-15(19)14(17)7-5-10-18/h3,10-11,14,16H,1,4-9,12H2,2H3/t14-,16+,17-/m0/s1 |
| InChIKey | FXVVQJNOVKEOTK-UAGQMJEPSA-N |
| XLogP | 2.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|