C19H18N4O2 — CID 53342024
3-[3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]-1-methylindole (PubChem CID 53342024) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-[3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]-1-methylindole.
| Compound Name | 3-[3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]-1-methylindole |
|---|---|
| PubChem CID | 53342024 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-[3-(3,4-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]-1-methylindole |
| SMILES | COc1ccc(-c2n[nH]c(-c3cn(C)c4ccccc34)n2)cc1OC |
| InChI | InChI=1S/C19H18N4O2/c1-23-11-14(13-6-4-5-7-15(13)23)19-20-18(21-22-19)12-8-9-16(24-2)17(10-12)25-3/h4-11H,1-3H3,(H,20,21,22) |
| InChIKey | BERKZZKMBJLOOD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |