C20H28BNO2 — CID 53342214
6-methyl-2-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-7,8-dihydro-5H-[1,3,2]dioxaborolo[4,5-g]isoquinoline (PubChem CID 53342214) has the molecular formula C20H28BNO2 and a molecular weight of 325.26 g/mol. Its IUPAC name is 6-methyl-2-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-7,8-dihydro-5H-[1,3,2]dioxaborolo[4,5-g]isoquinoline.
| Compound Name | 6-methyl-2-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-7,8-dihydro-5H-[1,3,2]dioxaborolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 53342214 |
| Molecular Formula | C20H28BNO2 |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 6-methyl-2-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-7,8-dihydro-5H-[1,3,2]dioxaborolo[4,5-g]isoquinoline |
| SMILES | C[C@@H]1[C@@H](B2Oc3cc4c(cc3O2)CN(C)CC4)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C20H28BNO2/c1-12-16-9-15(20(16,2)3)10-17(12)21-23-18-7-13-5-6-22(4)11-14(13)8-19(18)24-21/h7-8,12,15-17H,5-6,9-11H2,1-4H3/t12-,15+,16-,17-/m0/s1 |
| InChIKey | JFPYFQNBRKFXMG-IEAZIUSSSA-N |
| XLogP | 4.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|