C34H50NO+ — CID 53342268
(1R,3S,4S,7S,8S,10R)-1-[(3,5-ditert-butylphenyl)methyl]-3,8,10-trimethyl-3-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decane (PubChem CID 53342268) has the molecular formula C34H50NO+ and a molecular weight of 488.78 g/mol. Its IUPAC name is (1R,3S,4S,7S,8S,10R)-1-[(3,5-ditert-butylphenyl)methyl]-3,8,10-trimethyl-3-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decane.
| Compound Name | (1R,3S,4S,7S,8S,10R)-1-[(3,5-ditert-butylphenyl)methyl]-3,8,10-trimethyl-3-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 53342268 |
| Molecular Formula | C34H50NO+ |
| Molecular Weight | 488.78 g/mol |
| Exact Mass | 488.39 |
| IUPAC Name | (1R,3S,4S,7S,8S,10R)-1-[(3,5-ditert-butylphenyl)methyl]-3,8,10-trimethyl-3-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decane |
| SMILES | C[C@@H]1C[N@@+]2(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3)C[C@@](C)(OCc3ccccc3)[C@H]3CC[C@@H]1[C@]32C |
| InChI | InChI=1S/C34H50NO/c1-24-20-35(21-26-17-27(31(2,3)4)19-28(18-26)32(5,6)7)23-33(8,30-16-15-29(24)34(30,35)9)36-22-25-13-11-10-12-14-25/h10-14,17-19,24,29-30H,15-16,20-23H2,1-9H3/q+1/t24-,29+,30-,33-,34-,35-/m1/s1 |
| InChIKey | SARZWPVRNVYNTB-JGAXBGIVSA-N |
| XLogP | 8.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.78 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|