C17H28O2Si — CID 53342371
(1aR,1bS,4R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-1b-methyl-1,1a,2,3,4,6a-hexahydrocyclopropa[a]inden-6-one (PubChem CID 53342371) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is (1aR,1bS,4R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-1b-methyl-1,1a,2,3,4,6a-hexahydrocyclopropa[a]inden-6-one.
| Compound Name | (1aR,1bS,4R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-1b-methyl-1,1a,2,3,4,6a-hexahydrocyclopropa[a]inden-6-one |
|---|---|
| PubChem CID | 53342371 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (1aR,1bS,4R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-1b-methyl-1,1a,2,3,4,6a-hexahydrocyclopropa[a]inden-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C2C(=O)[C@H]3C[C@H]3[C@]2(C)CC1 |
| InChI | InChI=1S/C17H28O2Si/c1-16(2,3)20(5,6)19-11-7-8-17(4)13-10-12(13)15(18)14(17)9-11/h9,11-13H,7-8,10H2,1-6H3/t11-,12+,13-,17+/m1/s1 |
| InChIKey | UPKCESWZSGSUSP-ZHRONYKTSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|