C10H14O3 — CID 53342411
(1aS,2aR,5aS,6aR)-3,3-dimethyl-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f][2]benzofuran-5-one (PubChem CID 53342411) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (1aS,2aR,5aS,6aR)-3,3-dimethyl-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f][2]benzofuran-5-one.
| Compound Name | (1aS,2aR,5aS,6aR)-3,3-dimethyl-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f][2]benzofuran-5-one |
|---|---|
| PubChem CID | 53342411 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (1aS,2aR,5aS,6aR)-3,3-dimethyl-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f][2]benzofuran-5-one |
| SMILES | CC1(C)OC(=O)[C@H]2C[C@H]3O[C@H]3C[C@H]21 |
| InChI | InChI=1S/C10H14O3/c1-10(2)6-4-8-7(12-8)3-5(6)9(11)13-10/h5-8H,3-4H2,1-2H3/t5-,6+,7+,8-/m0/s1 |
| InChIKey | SZBONFDNEYPDHO-OSMVPFSASA-N |
| XLogP | 1.12 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|