C22H23NO4 — CID 53342756
ethyl (2R,3R)-2-(benzhydrylamino)-3-(furan-2-yl)-3-hydroxypropanoate (PubChem CID 53342756) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is ethyl (2R,3R)-2-(benzhydrylamino)-3-(furan-2-yl)-3-hydroxypropanoate.
| Compound Name | ethyl (2R,3R)-2-(benzhydrylamino)-3-(furan-2-yl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 53342756 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | ethyl (2R,3R)-2-(benzhydrylamino)-3-(furan-2-yl)-3-hydroxypropanoate |
| SMILES | CCOC(=O)[C@H](NC(c1ccccc1)c1ccccc1)[C@@H](O)c1ccco1 |
| InChI | InChI=1S/C22H23NO4/c1-2-26-22(25)20(21(24)18-14-9-15-27-18)23-19(16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-15,19-21,23-24H,2H2,1H3/t20-,21+/m1/s1 |
| InChIKey | FDXOEFCDVGPXSA-RTWAWAEBSA-N |
| XLogP | 3.62 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |