C15H11F6N3O5 — CID 53342809
[4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl] 4-methoxybenzoate (PubChem CID 53342809) has the molecular formula C15H11F6N3O5 and a molecular weight of 427.26 g/mol. Its IUPAC name is [4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl] 4-methoxybenzoate.
| Compound Name | [4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 53342809 |
| Molecular Formula | C15H11F6N3O5 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | [4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2nc(OCC(F)(F)F)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C15H11F6N3O5/c1-26-9-4-2-8(3-5-9)10(25)29-13-23-11(27-6-14(16,17)18)22-12(24-13)28-7-15(19,20)21/h2-5H,6-7H2,1H3 |
| InChIKey | WEQRGNCCOYEQSX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |