About tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate
tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate (PubChem CID 53342850) has the molecular formula C12H14F5NO4S
and a molecular weight of 363.30 g/mol. Its IUPAC name is tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate |
| PubChem CID | 53342850 |
| Molecular Formula | C12H14F5NO4S |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1ccc(S(F)(F)(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14F5NO4S/c1-12(2,3)22-11(19)6-8-4-5-9(7-10(8)18(20)21)23(13,14,15,16)17/h4-5,7H,6H2,1-3H3 |
| InChIKey | PONDFPZDBLCGBQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate?
The IUPAC name of tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate (CID 53342850) is tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate.
What is the SMILES notation for tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate?
The canonical SMILES for tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate is CC(C)(C)OC(=O)Cc1ccc(S(F)(F)(F)(F)F)cc1[N+](=O)[O-].
What is the InChIKey of tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate?
The InChIKey is PONDFPZDBLCGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F5NO4S/c1-12(2,3)22-11(19)6-8-4-5-9(7-10(8)18(20)21)23(13,14,15,16)17/h4-5,7H,6H2,1-3H3.
What are the key properties of tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate?
tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate has a molecular weight of 363.30 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]acetate is sourced from PubChem (CID 53342850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).