C36H54BrNO — CID 53342976
(1R,3S,4S,7S,8S,10R)-1-[(3,5-ditert-butylphenyl)methyl]-8,10-dimethyl-3-phenylmethoxy-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane bromide (PubChem CID 53342976) has the molecular formula C36H54BrNO and a molecular weight of 596.74 g/mol. Its IUPAC name is (1R,3S,4S,7S,8S,10R)-1-[(3,5-ditert-butylphenyl)methyl]-8,10-dimethyl-3-phenylmethoxy-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane bromide.
| Compound Name | (1R,3S,4S,7S,8S,10R)-1-[(3,5-ditert-butylphenyl)methyl]-8,10-dimethyl-3-phenylmethoxy-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane bromide |
|---|---|
| PubChem CID | 53342976 |
| Molecular Formula | C36H54BrNO |
| Molecular Weight | 596.74 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | (1R,3S,4S,7S,8S,10R)-1-[(3,5-ditert-butylphenyl)methyl]-8,10-dimethyl-3-phenylmethoxy-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane bromide |
| SMILES | CC(C)[C@@]1(OCc2ccccc2)C[N@+]2(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3)C[C@@H](C)[C@@H]3CC[C@H]1[C@@]32C.[Br-] |
| InChI | InChI=1S/C36H54NO.BrH/c1-25(2)36(38-23-27-14-12-11-13-15-27)24-37(21-26(3)31-16-17-32(36)35(31,37)10)22-28-18-29(33(4,5)6)20-30(19-28)34(7,8)9;/h11-15,18-20,25-26,31-32H,16-17,21-24H2,1-10H3;1H/q+1;/p-1/t26-,31+,32+,35-,36+,37-;/m1./s1 |
| InChIKey | OAGYKLCFKWZWRF-VBMUCYGLSA-M |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|