About (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide
(S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide (PubChem CID 53343030) has the molecular formula C10H20N2OS
and a molecular weight of 216.35 g/mol. Its IUPAC name is (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 53343030 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[C@H](C#N)N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C10H20N2OS/c1-9(2,3)8(7-11)12-14(13)10(4,5)6/h8,12H,1-6H3/t8-,14-/m0/s1 |
| InChIKey | TZVVKQVAZDYBKA-RTHLEPHNSA-N |
| XLogP | 1.98 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide?
The IUPAC name of (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide (CID 53343030) is (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide is CC(C)(C)[C@H](C#N)N[S@@](=O)C(C)(C)C.
What is the InChIKey of (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide?
The InChIKey is TZVVKQVAZDYBKA-RTHLEPHNSA-N. The full InChI is InChI=1S/C10H20N2OS/c1-9(2,3)8(7-11)12-14(13)10(4,5)6/h8,12H,1-6H3/t8-,14-/m0/s1.
What are the key properties of (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide?
(S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide has a molecular weight of 216.35 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 53343030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).