C30H31N2O+ — CID 53343174
(1R,3S,4S,7S,10R)-1-(anthracen-9-ylmethyl)-10-methyl-3-pyridin-2-yloxy-1-azoniatricyclo[5.2.1.04,10]decane (PubChem CID 53343174) has the molecular formula C30H31N2O+ and a molecular weight of 435.59 g/mol. Its IUPAC name is (1R,3S,4S,7S,10R)-1-(anthracen-9-ylmethyl)-10-methyl-3-pyridin-2-yloxy-1-azoniatricyclo[5.2.1.04,10]decane.
| Compound Name | (1R,3S,4S,7S,10R)-1-(anthracen-9-ylmethyl)-10-methyl-3-pyridin-2-yloxy-1-azoniatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 53343174 |
| Molecular Formula | C30H31N2O+ |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | (1R,3S,4S,7S,10R)-1-(anthracen-9-ylmethyl)-10-methyl-3-pyridin-2-yloxy-1-azoniatricyclo[5.2.1.04,10]decane |
| SMILES | C[C@@]12[C@H]3CC[C@@H]1[C@H](Oc1ccccn1)C[N@+]2(Cc1c2ccccc2cc2ccccc12)CC3 |
| InChI | InChI=1S/C30H31N2O/c1-30-23-13-14-27(30)28(33-29-12-6-7-16-31-29)20-32(30,17-15-23)19-26-24-10-4-2-8-21(24)18-22-9-3-5-11-25(22)26/h2-12,16,18,23,27-28H,13-15,17,19-20H2,1H3/q+1/t23-,27+,28+,30+,32+/m0/s1 |
| InChIKey | YOKHSKQCMYVWIN-XQXVZJNSSA-N |
| XLogP | 6.35 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|