C15H27Cl2N — CID 53343187
(1S,2S,5S,6R)-2,6-dichloro-9-heptyl-9-azabicyclo[3.3.1]nonane (PubChem CID 53343187) has the molecular formula C15H27Cl2N and a molecular weight of 292.29 g/mol. Its IUPAC name is (1S,2S,5S,6R)-2,6-dichloro-9-heptyl-9-azabicyclo[3.3.1]nonane.
| Compound Name | (1S,2S,5S,6R)-2,6-dichloro-9-heptyl-9-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 53343187 |
| Molecular Formula | C15H27Cl2N |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (1S,2S,5S,6R)-2,6-dichloro-9-heptyl-9-azabicyclo[3.3.1]nonane |
| SMILES | CCCCCCCN1[C@H]2CC[C@H](Cl)[C@@H]1CC[C@H]2Cl |
| InChI | InChI=1S/C15H27Cl2N/c1-2-3-4-5-6-11-18-14-9-7-12(16)15(18)10-8-13(14)17/h12-15H,2-11H2,1H3/t12-,13+,14-,15-/m0/s1 |
| InChIKey | YAFIJTOGTGBVSC-XGUBFFRZSA-N |
| XLogP | 4.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|