C11H15Cl2N — CID 53343189
(1S,2S,5S,6R)-2,6-dichloro-9-prop-2-ynyl-9-azabicyclo[3.3.1]nonane (PubChem CID 53343189) has the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. Its IUPAC name is (1S,2S,5S,6R)-2,6-dichloro-9-prop-2-ynyl-9-azabicyclo[3.3.1]nonane.
| Compound Name | (1S,2S,5S,6R)-2,6-dichloro-9-prop-2-ynyl-9-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 53343189 |
| Molecular Formula | C11H15Cl2N |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | (1S,2S,5S,6R)-2,6-dichloro-9-prop-2-ynyl-9-azabicyclo[3.3.1]nonane |
| SMILES | C#CCN1[C@H]2CC[C@H](Cl)[C@@H]1CC[C@H]2Cl |
| InChI | InChI=1S/C11H15Cl2N/c1-2-7-14-10-5-3-8(12)11(14)6-4-9(10)13/h1,8-11H,3-7H2/t8-,9+,10-,11-/m0/s1 |
| InChIKey | KWARUVYCNWECFK-VLEAKVRGSA-N |
| XLogP | 2.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|