C8H11F5N2OS — CID 53343220
(S)-N-[(1S)-1-cyano-2,2-dimethylpropyl]-1,1,2,2,2-pentafluoroethanesulfinamide (PubChem CID 53343220) has the molecular formula C8H11F5N2OS and a molecular weight of 278.25 g/mol. Its IUPAC name is (S)-N-[(1S)-1-cyano-2,2-dimethylpropyl]-1,1,2,2,2-pentafluoroethanesulfinamide.
| Compound Name | (S)-N-[(1S)-1-cyano-2,2-dimethylpropyl]-1,1,2,2,2-pentafluoroethanesulfinamide |
|---|---|
| PubChem CID | 53343220 |
| Molecular Formula | C8H11F5N2OS |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (S)-N-[(1S)-1-cyano-2,2-dimethylpropyl]-1,1,2,2,2-pentafluoroethanesulfinamide |
| SMILES | CC(C)(C)[C@@H](C#N)N[S@@](=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H11F5N2OS/c1-6(2,3)5(4-14)15-17(16)8(12,13)7(9,10)11/h5,15H,1-3H3/t5-,17+/m1/s1 |
| InChIKey | XBFBHRPMPZXUBD-NEXAQPNMSA-N |
| XLogP | 2.33 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|