C33H42BrNO2 — CID 53343380
(1R,3S,4S,7S,8S,10R)-3-[(4-methoxyphenyl)methoxy]-8,10-dimethyl-1-(naphthalen-1-ylmethyl)-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane bromide (PubChem CID 53343380) has the molecular formula C33H42BrNO2 and a molecular weight of 564.61 g/mol. Its IUPAC name is (1R,3S,4S,7S,8S,10R)-3-[(4-methoxyphenyl)methoxy]-8,10-dimethyl-1-(naphthalen-1-ylmethyl)-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane bromide.
| Compound Name | (1R,3S,4S,7S,8S,10R)-3-[(4-methoxyphenyl)methoxy]-8,10-dimethyl-1-(naphthalen-1-ylmethyl)-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane bromide |
|---|---|
| PubChem CID | 53343380 |
| Molecular Formula | C33H42BrNO2 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | (1R,3S,4S,7S,8S,10R)-3-[(4-methoxyphenyl)methoxy]-8,10-dimethyl-1-(naphthalen-1-ylmethyl)-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane bromide |
| SMILES | COc1ccc(CO[C@]2(C(C)C)C[N@+]3(Cc4cccc5ccccc45)C[C@@H](C)[C@@H]4CC[C@H]2[C@@]43C)cc1.[Br-] |
| InChI | InChI=1S/C33H42NO2.BrH/c1-23(2)33(36-21-25-13-15-28(35-5)16-14-25)22-34(19-24(3)30-17-18-31(33)32(30,34)4)20-27-11-8-10-26-9-6-7-12-29(26)27;/h6-16,23-24,30-31H,17-22H2,1-5H3;1H/q+1;/p-1/t24-,30+,31+,32-,33+,34-;/m1./s1 |
| InChIKey | ZWHLOPJJFWGFRB-ASKAEJFUSA-M |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|