About spiro[2.5]octane-2,2-dicarbonitrile
spiro[2.5]octane-2,2-dicarbonitrile (PubChem CID 533434) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is spiro[2.5]octane-2,2-dicarbonitrile.
Molecular Properties
| Compound Name | spiro[2.5]octane-2,2-dicarbonitrile |
| PubChem CID | 533434 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | spiro[2.5]octane-2,2-dicarbonitrile |
| SMILES | N#CC1(C#N)CC12CCCCC2 |
| InChI | InChI=1S/C10H12N2/c11-7-10(8-12)6-9(10)4-2-1-3-5-9/h1-6H2 |
| InChIKey | VLZXRXNSCITITC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[2.5]octane-2,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2.5]octane-2,2-dicarbonitrile?
The IUPAC name of spiro[2.5]octane-2,2-dicarbonitrile (CID 533434) is spiro[2.5]octane-2,2-dicarbonitrile.
What is the SMILES notation for spiro[2.5]octane-2,2-dicarbonitrile?
The canonical SMILES for spiro[2.5]octane-2,2-dicarbonitrile is N#CC1(C#N)CC12CCCCC2.
What is the InChIKey of spiro[2.5]octane-2,2-dicarbonitrile?
The InChIKey is VLZXRXNSCITITC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c11-7-10(8-12)6-9(10)4-2-1-3-5-9/h1-6H2.
What are the key properties of spiro[2.5]octane-2,2-dicarbonitrile?
spiro[2.5]octane-2,2-dicarbonitrile has a molecular weight of 160.22 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.5]octane-2,2-dicarbonitrile is sourced from PubChem (CID 533434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).