C18H21IO6 — CID 53343502
methyl (2E,6E)-8-[2-(3-iodo-6-oxopyran-2-yl)acetyl]oxy-2,6-dimethylocta-2,6-dienoate (PubChem CID 53343502) has the molecular formula C18H21IO6 and a molecular weight of 460.26 g/mol. Its IUPAC name is methyl (2E,6E)-8-[2-(3-iodo-6-oxopyran-2-yl)acetyl]oxy-2,6-dimethylocta-2,6-dienoate.
| Compound Name | methyl (2E,6E)-8-[2-(3-iodo-6-oxopyran-2-yl)acetyl]oxy-2,6-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 53343502 |
| Molecular Formula | C18H21IO6 |
| Molecular Weight | 460.26 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | methyl (2E,6E)-8-[2-(3-iodo-6-oxopyran-2-yl)acetyl]oxy-2,6-dimethylocta-2,6-dienoate |
| SMILES | COC(=O)/C(C)=C/CC/C(C)=C/COC(=O)Cc1oc(=O)ccc1I |
| InChI | InChI=1S/C18H21IO6/c1-12(5-4-6-13(2)18(22)23-3)9-10-24-17(21)11-15-14(19)7-8-16(20)25-15/h6-9H,4-5,10-11H2,1-3H3/b12-9+,13-6+ |
| InChIKey | UWAFXTDYFOUPSD-GOPAXJRYSA-N |
| XLogP | 3.18 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|