About 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline
3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline (PubChem CID 53343599) has the molecular formula C26H16N6S2
and a molecular weight of 476.59 g/mol. Its IUPAC name is 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline.
Molecular Properties
| Compound Name | 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline |
| PubChem CID | 53343599 |
| Molecular Formula | C26H16N6S2 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline |
| SMILES | c1cn(-c2ccc(-c3cnc4c(ccc5cc(-c6ccc(-n7ccnc7)s6)cnc54)c3)s2)cn1 |
| InChI | InChI=1S/C26H16N6S2/c1-2-18-12-20(22-4-6-24(34-22)32-10-8-28-16-32)14-30-26(18)25-17(1)11-19(13-29-25)21-3-5-23(33-21)31-9-7-27-15-31/h1-16H |
| InChIKey | QAWSOBDTNRCYHP-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline?
The IUPAC name of 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline (CID 53343599) is 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline.
What is the SMILES notation for 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline?
The canonical SMILES for 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline is c1cn(-c2ccc(-c3cnc4c(ccc5cc(-c6ccc(-n7ccnc7)s6)cnc54)c3)s2)cn1.
What is the InChIKey of 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline?
The InChIKey is QAWSOBDTNRCYHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16N6S2/c1-2-18-12-20(22-4-6-24(34-22)32-10-8-28-16-32)14-30-26(18)25-17(1)11-19(13-29-25)21-3-5-23(33-21)31-9-7-27-15-31/h1-16H.
What are the key properties of 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline?
3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline has a molecular weight of 476.59 g/mol, XLogP of 6.61, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline is sourced from PubChem (CID 53343599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).