C18H25NO3 — CID 53343702
(1R,4R)-4-ethenyl-13-(1-hydroxypropyl)-11-methyl-5-azatricyclo[8.3.0.01,5]tridec-10-ene-6,12-dione (PubChem CID 53343702) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (1R,4R)-4-ethenyl-13-(1-hydroxypropyl)-11-methyl-5-azatricyclo[8.3.0.01,5]tridec-10-ene-6,12-dione.
| Compound Name | (1R,4R)-4-ethenyl-13-(1-hydroxypropyl)-11-methyl-5-azatricyclo[8.3.0.01,5]tridec-10-ene-6,12-dione |
|---|---|
| PubChem CID | 53343702 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (1R,4R)-4-ethenyl-13-(1-hydroxypropyl)-11-methyl-5-azatricyclo[8.3.0.01,5]tridec-10-ene-6,12-dione |
| SMILES | C=C[C@H]1CC[C@]23C(=C(C)C(=O)C2C(O)CC)CCCC(=O)N13 |
| InChI | InChI=1S/C18H25NO3/c1-4-12-9-10-18-13(7-6-8-15(21)19(12)18)11(3)17(22)16(18)14(20)5-2/h4,12,14,16,20H,1,5-10H2,2-3H3/t12-,14?,16?,18-/m0/s1 |
| InChIKey | LRIPEMCEGTUFCO-QZXDYEHLSA-N |
| XLogP | 2.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|