C20H25NO4 — CID 53343707
(1S,4R,13S)-4-ethenyl-4'-methoxy-3',11-dimethylspiro[5-azatricyclo[8.3.0.01,5]tridec-10-ene-13,5'-furan]-2',12-dione (PubChem CID 53343707) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (1S,4R,13S)-4-ethenyl-4'-methoxy-3',11-dimethylspiro[5-azatricyclo[8.3.0.01,5]tridec-10-ene-13,5'-furan]-2',12-dione.
| Compound Name | (1S,4R,13S)-4-ethenyl-4'-methoxy-3',11-dimethylspiro[5-azatricyclo[8.3.0.01,5]tridec-10-ene-13,5'-furan]-2',12-dione |
|---|---|
| PubChem CID | 53343707 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (1S,4R,13S)-4-ethenyl-4'-methoxy-3',11-dimethylspiro[5-azatricyclo[8.3.0.01,5]tridec-10-ene-13,5'-furan]-2',12-dione |
| SMILES | C=C[C@H]1CC[C@]23C(=C(C)C(=O)[C@]24OC(=O)C(C)=C4OC)CCCCN13 |
| InChI | InChI=1S/C20H25NO4/c1-5-14-9-10-19-15(8-6-7-11-21(14)19)12(2)16(22)20(19)17(24-4)13(3)18(23)25-20/h5,14H,1,6-11H2,2-4H3/t14-,19-,20+/m0/s1 |
| InChIKey | ZDXZXMDBICSWQK-PNHOKKKMSA-N |
| XLogP | 2.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|