C26H29N2O+ — CID 53343958
(1R,3R,4S,7S,10R)-10-methyl-1-(naphthalen-2-ylmethyl)-3-pyridin-2-yloxy-1-azoniatricyclo[5.2.1.04,10]decane (PubChem CID 53343958) has the molecular formula C26H29N2O+ and a molecular weight of 385.53 g/mol. Its IUPAC name is (1R,3R,4S,7S,10R)-10-methyl-1-(naphthalen-2-ylmethyl)-3-pyridin-2-yloxy-1-azoniatricyclo[5.2.1.04,10]decane.
| Compound Name | (1R,3R,4S,7S,10R)-10-methyl-1-(naphthalen-2-ylmethyl)-3-pyridin-2-yloxy-1-azoniatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 53343958 |
| Molecular Formula | C26H29N2O+ |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (1R,3R,4S,7S,10R)-10-methyl-1-(naphthalen-2-ylmethyl)-3-pyridin-2-yloxy-1-azoniatricyclo[5.2.1.04,10]decane |
| SMILES | C[C@@]12[C@H]3CC[C@@H]1[C@@H](Oc1ccccn1)C[N@+]2(Cc1ccc2ccccc2c1)CC3 |
| InChI | InChI=1S/C26H29N2O/c1-26-22-11-12-23(26)24(29-25-8-4-5-14-27-25)18-28(26,15-13-22)17-19-9-10-20-6-2-3-7-21(20)16-19/h2-10,14,16,22-24H,11-13,15,17-18H2,1H3/q+1/t22-,23+,24-,26+,28+/m0/s1 |
| InChIKey | GSGQAETWGHQZOQ-QICCJJJUSA-N |
| XLogP | 5.20 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|