C16H29NO3Si — CID 53344029
(4S)-4-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-prop-2-enyl-1,3-oxazolidin-2-one (PubChem CID 53344029) has the molecular formula C16H29NO3Si and a molecular weight of 311.50 g/mol. Its IUPAC name is (4S)-4-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-prop-2-enyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-prop-2-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 53344029 |
| Molecular Formula | C16H29NO3Si |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (4S)-4-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-prop-2-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CCN1C(=O)OC[C@H]1[C@@H](/C=C/C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H29NO3Si/c1-8-10-14(20-21(6,7)16(3,4)5)13-12-19-15(18)17(13)11-9-2/h8-10,13-14H,2,11-12H2,1,3-7H3/b10-8+/t13-,14+/m0/s1 |
| InChIKey | QKQOADIAOFPJSJ-JSPBLOFBSA-N |
| XLogP | 3.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|