C20H30O6Si — CID 53344063
(1S,2R,6R,10R,11R)-2-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-9,13-dione (PubChem CID 53344063) has the molecular formula C20H30O6Si and a molecular weight of 394.54 g/mol. Its IUPAC name is (1S,2R,6R,10R,11R)-2-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-9,13-dione.
| Compound Name | (1S,2R,6R,10R,11R)-2-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-9,13-dione |
|---|---|
| PubChem CID | 53344063 |
| Molecular Formula | C20H30O6Si |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (1S,2R,6R,10R,11R)-2-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-6-methyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-9,13-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC=C2[C@]13CC(=O)O[C@H](C3)[C@@]1(O)C(=O)OC[C@@]21C |
| InChI | InChI=1S/C20H30O6Si/c1-17(2,3)27(5,6)26-13-8-7-12-18(4)11-24-16(22)20(18,23)14-9-19(12,13)10-15(21)25-14/h7,13-14,23H,8-11H2,1-6H3/t13-,14-,18+,19+,20-/m1/s1 |
| InChIKey | BDELTGGJOPKDLG-SZPOEPLOSA-N |
| XLogP | 2.71 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|