C20H30O7Si — CID 53344067
(1R,2R,6R,7R,9S)-6-hydroxy-2-methyl-7-triethylsilyloxy-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,11,15-trione (PubChem CID 53344067) has the molecular formula C20H30O7Si and a molecular weight of 410.54 g/mol. Its IUPAC name is (1R,2R,6R,7R,9S)-6-hydroxy-2-methyl-7-triethylsilyloxy-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,11,15-trione.
| Compound Name | (1R,2R,6R,7R,9S)-6-hydroxy-2-methyl-7-triethylsilyloxy-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,11,15-trione |
|---|---|
| PubChem CID | 53344067 |
| Molecular Formula | C20H30O7Si |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (1R,2R,6R,7R,9S)-6-hydroxy-2-methyl-7-triethylsilyloxy-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,11,15-trione |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@]23CC(=O)O[C@]2(CCC3=O)[C@]2(C)COC(=O)[C@]12O |
| InChI | InChI=1S/C20H30O7Si/c1-5-28(6-2,7-3)27-14-10-18-11-15(22)26-19(18,9-8-13(18)21)17(4)12-25-16(23)20(14,17)24/h14,24H,5-12H2,1-4H3/t14-,17+,18-,19-,20-/m1/s1 |
| InChIKey | UUUDFKXYGNUEPH-PBOLBBRVSA-N |
| XLogP | 2.11 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|