C34H36BrF6NO2 — CID 53344154
(1R,3R,4S,7S,8S,10R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-[(4-methoxyphenyl)methyl]-8,10-dimethyl-3-phenyl-1-azoniatricyclo[5.2.1.04,10]decane bromide (PubChem CID 53344154) has the molecular formula C34H36BrF6NO2 and a molecular weight of 684.56 g/mol. Its IUPAC name is (1R,3R,4S,7S,8S,10R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-[(4-methoxyphenyl)methyl]-8,10-dimethyl-3-phenyl-1-azoniatricyclo[5.2.1.04,10]decane bromide.
| Compound Name | (1R,3R,4S,7S,8S,10R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-[(4-methoxyphenyl)methyl]-8,10-dimethyl-3-phenyl-1-azoniatricyclo[5.2.1.04,10]decane bromide |
|---|---|
| PubChem CID | 53344154 |
| Molecular Formula | C34H36BrF6NO2 |
| Molecular Weight | 684.56 g/mol |
| Exact Mass | 683.18 |
| IUPAC Name | (1R,3R,4S,7S,8S,10R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-[(4-methoxyphenyl)methyl]-8,10-dimethyl-3-phenyl-1-azoniatricyclo[5.2.1.04,10]decane bromide |
| SMILES | COc1ccc(C[N@@+]23C[C@@H](C)[C@@H]4CC[C@@H]([C@@]42C)[C@@](OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)C3)cc1.[Br-] |
| InChI | InChI=1S/C34H36F6NO2.BrH/c1-22-18-41(19-23-9-11-28(42-3)12-10-23)21-32(25-7-5-4-6-8-25,30-14-13-29(22)31(30,41)2)43-20-24-15-26(33(35,36)37)17-27(16-24)34(38,39)40;/h4-12,15-17,22,29-30H,13-14,18-21H2,1-3H3;1H/q+1;/p-1/t22-,29+,30+,31-,32+,41-;/m1./s1 |
| InChIKey | GJIBADQOJCDZPO-OBGIBVNXSA-M |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|