C60H68O12 — CID 53344219
14,27-dimethyl-16,16,25,25-tetraphenyl-2,5,8,11,15,26,30,33,36,39-decaoxatetracyclo[38.4.0.013,17.024,28]tetratetraconta-1(44),13,27,40,42-pentaene-12,29-dione (PubChem CID 53344219) has the molecular formula C60H68O12 and a molecular weight of 981.19 g/mol. Its IUPAC name is 14,27-dimethyl-16,16,25,25-tetraphenyl-2,5,8,11,15,26,30,33,36,39-decaoxatetracyclo[38.4.0.013,17.024,28]tetratetraconta-1(44),13,27,40,42-pentaene-12,29-dione.
| Compound Name | 14,27-dimethyl-16,16,25,25-tetraphenyl-2,5,8,11,15,26,30,33,36,39-decaoxatetracyclo[38.4.0.013,17.024,28]tetratetraconta-1(44),13,27,40,42-pentaene-12,29-dione |
|---|---|
| PubChem CID | 53344219 |
| Molecular Formula | C60H68O12 |
| Molecular Weight | 981.19 g/mol |
| Exact Mass | 980.47 |
| IUPAC Name | 14,27-dimethyl-16,16,25,25-tetraphenyl-2,5,8,11,15,26,30,33,36,39-decaoxatetracyclo[38.4.0.013,17.024,28]tetratetraconta-1(44),13,27,40,42-pentaene-12,29-dione |
| SMILES | CC1=C2C(=O)OCCOCCOCCOc3ccccc3OCCOCCOCCOC(=O)C3=C(C)OC(c4ccccc4)(c4ccccc4)C3CCCCCCC2C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C60H68O12/c1-45-55-51(59(71-45,47-21-9-5-10-22-47)48-23-11-6-12-24-48)29-17-3-4-18-30-52-56(46(2)72-60(52,49-25-13-7-14-26-49)50-27-15-8-16-28-50)58(62)70-44-40-66-36-34-64-38-42-68-54-32-20-19-31-53(54)67-41-37-63-33-35-65-39-43-69-57(55)61/h5-16,19-28,31-32,51-52H,3-4,17-18,29-30,33-44H2,1-2H3 |
| InChIKey | SIIXEWPOZZPPTA-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.19 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |