C35H46N2O6 — CID 53344271
[(2R,4E,6E,10S,11S,12E,18E)-2-[(2R,3E,5E)-6-benzamido-4-methylhexa-3,5-dien-2-yl]-11-hydroxy-4-methyl-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate (PubChem CID 53344271) has the molecular formula C35H46N2O6 and a molecular weight of 590.76 g/mol. Its IUPAC name is [(2R,4E,6E,10S,11S,12E,18E)-2-[(2R,3E,5E)-6-benzamido-4-methylhexa-3,5-dien-2-yl]-11-hydroxy-4-methyl-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate.
| Compound Name | [(2R,4E,6E,10S,11S,12E,18E)-2-[(2R,3E,5E)-6-benzamido-4-methylhexa-3,5-dien-2-yl]-11-hydroxy-4-methyl-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate |
|---|---|
| PubChem CID | 53344271 |
| Molecular Formula | C35H46N2O6 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | [(2R,4E,6E,10S,11S,12E,18E)-2-[(2R,3E,5E)-6-benzamido-4-methylhexa-3,5-dien-2-yl]-11-hydroxy-4-methyl-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate |
| SMILES | CC(/C=C/NC(=O)c1ccccc1)=C\[C@@H](C)[C@H]1C/C(C)=C/C=C/CC[C@H](OC(N)=O)[C@@H](O)/C=C/CCCC/C=C/C(=O)O1 |
| InChI | InChI=1S/C35H46N2O6/c1-26-16-10-8-14-20-31(43-35(36)41)30(38)19-13-6-4-5-7-15-21-33(39)42-32(25-26)28(3)24-27(2)22-23-37-34(40)29-17-11-9-12-18-29/h8-13,15-19,21-24,28,30-32,38H,4-7,14,20,25H2,1-3H3,(H2,36,41)(H,37,40)/b10-8+,19-13+,21-15+,23-22+,26-16+,27-24+/t28-,30+,31+,32-/m1/s1 |
| InChIKey | JSXFSVUNCIBOHH-XMGYPQQHSA-N |
| XLogP | 6.61 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|