C12H14N4O2 — CID 53344302
4-(2-azidoethyl)-3-benzyl-1,3-oxazolidin-2-one (PubChem CID 53344302) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-(2-azidoethyl)-3-benzyl-1,3-oxazolidin-2-one.
| Compound Name | 4-(2-azidoethyl)-3-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 53344302 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-(2-azidoethyl)-3-benzyl-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NCCC1COC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C12H14N4O2/c13-15-14-7-6-11-9-18-12(17)16(11)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | UTCUOQQTQPOSDZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|