C35H43N3O7SSi — CID 53344535
[(2R,3S,4R,5R,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-phenylsulfanyloxan-4-yl] acetate (PubChem CID 53344535) has the molecular formula C35H43N3O7SSi and a molecular weight of 677.90 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-phenylsulfanyloxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-phenylsulfanyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 53344535 |
| Molecular Formula | C35H43N3O7SSi |
| Molecular Weight | 677.90 g/mol |
| Exact Mass | 677.26 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-phenylsulfanyloxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](N=[N+]=[N-])[C@H](Sc2ccccc2)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H43N3O7SSi/c1-24(39)42-31-29(37-38-36)32(46-25-17-11-8-12-18-25)43-28(30(31)44-33(40)45-34(2,3)4)23-41-47(35(5,6)7,26-19-13-9-14-20-26)27-21-15-10-16-22-27/h8-22,28-32H,23H2,1-7H3/t28-,29-,30-,31-,32+/m1/s1 |
| InChIKey | OVEXJPNBRLKDTD-ROQXEPJXSA-N |
| XLogP | 7.01 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.90 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|