C29H32F5NO3 — CID 53344816
4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N,N-dimethylbenzamide (PubChem CID 53344816) has the molecular formula C29H32F5NO3 and a molecular weight of 537.57 g/mol. Its IUPAC name is 4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 53344816 |
| Molecular Formula | C29H32F5NO3 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc([C@H]2C[C@@]3(C)C(CC[C@@]3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C29H32F5NO3/c1-26-15-22(16-4-6-17(7-5-16)25(37)35(2)3)24-20-11-9-19(36)14-18(20)8-10-21(24)23(26)12-13-27(26,38)28(30,31)29(32,33)34/h4-7,14,21-23,38H,8-13,15H2,1-3H3/t21?,22-,23?,26+,27+/m1/s1 |
| InChIKey | RHGBOIUZBWETHU-CPJSSFQVSA-N |
| XLogP | 6.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|